C30H43NO5 — CID 11620246
benzyl N-[(Z,4R,9R,10R,11R,12R)-9,11-dihydroxy-10,12-dimethyl-13-phenylmethoxytridec-5-en-4-yl]carbamate (PubChem CID 11620246) has the molecular formula C30H43NO5 and a molecular weight of 497.68 g/mol. Its IUPAC name is benzyl N-[(Z,4R,9R,10R,11R,12R)-9,11-dihydroxy-10,12-dimethyl-13-phenylmethoxytridec-5-en-4-yl]carbamate.
| Compound Name | benzyl N-[(Z,4R,9R,10R,11R,12R)-9,11-dihydroxy-10,12-dimethyl-13-phenylmethoxytridec-5-en-4-yl]carbamate |
|---|---|
| PubChem CID | 11620246 |
| Molecular Formula | C30H43NO5 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | benzyl N-[(Z,4R,9R,10R,11R,12R)-9,11-dihydroxy-10,12-dimethyl-13-phenylmethoxytridec-5-en-4-yl]carbamate |
| SMILES | CCC[C@H](/C=C\CC[C@@H](O)[C@@H](C)[C@H](O)[C@H](C)COCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H43NO5/c1-4-13-27(31-30(34)36-22-26-16-9-6-10-17-26)18-11-12-19-28(32)24(3)29(33)23(2)20-35-21-25-14-7-5-8-15-25/h5-11,14-18,23-24,27-29,32-33H,4,12-13,19-22H2,1-3H3,(H,31,34)/b18-11-/t23-,24-,27-,28-,29-/m1/s1 |
| InChIKey | SRLULNWGYOFHJA-VJVPZXQGSA-N |
| XLogP | 5.63 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|