C26H27NO6 — CID 70815205
(2S,3R)-2,3-bis(phenylmethoxy)-4-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 70815205) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is (2S,3R)-2,3-bis(phenylmethoxy)-4-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S,3R)-2,3-bis(phenylmethoxy)-4-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 70815205 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (2S,3R)-2,3-bis(phenylmethoxy)-4-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(NC[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C26H27NO6/c28-25(29)24(32-18-21-12-6-2-7-13-21)23(31-17-20-10-4-1-5-11-20)16-27-26(30)33-19-22-14-8-3-9-15-22/h1-15,23-24H,16-19H2,(H,27,30)(H,28,29)/t23-,24+/m1/s1 |
| InChIKey | BJCGNHLYQWFWGV-RPWUZVMVSA-N |
| XLogP | 4.17 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |