C34H28F5NO7S — CID 11802753
(2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2,4,6-trimethoxyphenyl)methylsulfanyl]propanoate (PubChem CID 11802753) has the molecular formula C34H28F5NO7S and a molecular weight of 689.65 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2,4,6-trimethoxyphenyl)methylsulfanyl]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2,4,6-trimethoxyphenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 11802753 |
| Molecular Formula | C34H28F5NO7S |
| Molecular Weight | 689.65 g/mol |
| Exact Mass | 689.15 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2,4,6-trimethoxyphenyl)methylsulfanyl]propanoate |
| SMILES | COc1cc(OC)c(CSC[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)Oc2c(F)c(F)c(F)c(F)c2F)c(OC)c1 |
| InChI | InChI=1S/C34H28F5NO7S/c1-43-17-12-25(44-2)23(26(13-17)45-3)15-48-16-24(33(41)47-32-30(38)28(36)27(35)29(37)31(32)39)40-34(42)46-14-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22/h4-13,22,24H,14-16H2,1-3H3,(H,40,42)/t24-/m1/s1 |
| InChIKey | GUYMKGZPSDEEJW-XMMPIXPASA-N |
| XLogP | 7.15 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.65 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|