C20H25N5O6S — CID 70190025
3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(propoxycarbonylamino)propanoic acid (PubChem CID 70190025) has the molecular formula C20H25N5O6S and a molecular weight of 463.52 g/mol. Its IUPAC name is 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(propoxycarbonylamino)propanoic acid.
| Compound Name | 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(propoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 70190025 |
| Molecular Formula | C20H25N5O6S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(propoxycarbonylamino)propanoic acid |
| SMILES | CCCOC(=O)NC(CC(=O)O)c1cccc(NS(=O)(=O)c2cccc(N=C(N)N)c2)c1 |
| InChI | InChI=1S/C20H25N5O6S/c1-2-9-31-20(28)24-17(12-18(26)27)13-5-3-7-15(10-13)25-32(29,30)16-8-4-6-14(11-16)23-19(21)22/h3-8,10-11,17,25H,2,9,12H2,1H3,(H,24,28)(H,26,27)(H4,21,22,23) |
| InChIKey | YAROKJXLMQFHKW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 186.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|