C22H19F3N4O4S — CID 19076748
3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 19076748) has the molecular formula C22H19F3N4O4S and a molecular weight of 492.48 g/mol. Its IUPAC name is 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(3,4,5-trifluorophenyl)propanoic acid.
| Compound Name | 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 19076748 |
| Molecular Formula | C22H19F3N4O4S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(3,4,5-trifluorophenyl)propanoic acid |
| SMILES | NC(N)=Nc1cccc(S(=O)(=O)Nc2cccc(C(CC(=O)O)c3cc(F)c(F)c(F)c3)c2)c1 |
| InChI | InChI=1S/C22H19F3N4O4S/c23-18-8-13(9-19(24)21(18)25)17(11-20(30)31)12-3-1-5-15(7-12)29-34(32,33)16-6-2-4-14(10-16)28-22(26)27/h1-10,17,29H,11H2,(H,30,31)(H4,26,27,28) |
| InChIKey | CRNCAIDULSLYLY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|