C14H15FN6O2S — CID 168603569
1-(diaminomethylidene)-2-[3-[(4-fluorophenyl)sulfonylamino]phenyl]guanidine (PubChem CID 168603569) has the molecular formula C14H15FN6O2S and a molecular weight of 350.38 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-[(4-fluorophenyl)sulfonylamino]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-[(4-fluorophenyl)sulfonylamino]phenyl]guanidine |
|---|---|
| PubChem CID | 168603569 |
| Molecular Formula | C14H15FN6O2S |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-[(4-fluorophenyl)sulfonylamino]phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cccc(NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C14H15FN6O2S/c15-9-4-6-12(7-5-9)24(22,23)21-11-3-1-2-10(8-11)19-14(18)20-13(16)17/h1-8,21H,(H6,16,17,18,19,20) |
| InChIKey | NAMWISCIWGAUPA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|