C16H20N6O2S — CID 168603239
1-(diaminomethylidene)-2-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]guanidine (PubChem CID 168603239) has the molecular formula C16H20N6O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]guanidine |
|---|---|
| PubChem CID | 168603239 |
| Molecular Formula | C16H20N6O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]guanidine |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(/N=C(\N)N=C(N)N)cc2)c(C)c1 |
| InChI | InChI=1S/C16H20N6O2S/c1-10-3-8-14(11(2)9-10)22-25(23,24)13-6-4-12(5-7-13)20-16(19)21-15(17)18/h3-9,22H,1-2H3,(H6,17,18,19,20,21) |
| InChIKey | CMAVRLBYWOVQIK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|