C26H29N3O4S2 — CID 19076818
tert-butyl 3-[3-[[3-(carbamothioylamino)phenyl]sulfonylamino]phenyl]-3-phenylpropanoate (PubChem CID 19076818) has the molecular formula C26H29N3O4S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is tert-butyl 3-[3-[[3-(carbamothioylamino)phenyl]sulfonylamino]phenyl]-3-phenylpropanoate.
| Compound Name | tert-butyl 3-[3-[[3-(carbamothioylamino)phenyl]sulfonylamino]phenyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 19076818 |
| Molecular Formula | C26H29N3O4S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | tert-butyl 3-[3-[[3-(carbamothioylamino)phenyl]sulfonylamino]phenyl]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)CC(c1ccccc1)c1cccc(NS(=O)(=O)c2cccc(NC(N)=S)c2)c1 |
| InChI | InChI=1S/C26H29N3O4S2/c1-26(2,3)33-24(30)17-23(18-9-5-4-6-10-18)19-11-7-13-21(15-19)29-35(31,32)22-14-8-12-20(16-22)28-25(27)34/h4-16,23,29H,17H2,1-3H3,(H3,27,28,34) |
| InChIKey | BKHLVMYYVOCABA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|