C28H30N4O4S2 — CID 19076784
tert-butyl 3-[3-[[3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]sulfonylamino]phenyl]-3-phenylpropanoate (PubChem CID 19076784) has the molecular formula C28H30N4O4S2 and a molecular weight of 550.71 g/mol. Its IUPAC name is tert-butyl 3-[3-[[3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]sulfonylamino]phenyl]-3-phenylpropanoate.
| Compound Name | tert-butyl 3-[3-[[3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]sulfonylamino]phenyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 19076784 |
| Molecular Formula | C28H30N4O4S2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | tert-butyl 3-[3-[[3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]sulfonylamino]phenyl]-3-phenylpropanoate |
| SMILES | CS/C(=N\c1cccc(S(=O)(=O)Nc2cccc(C(CC(=O)OC(C)(C)C)c3ccccc3)c2)c1)NC#N |
| InChI | InChI=1S/C28H30N4O4S2/c1-28(2,3)36-26(33)18-25(20-10-6-5-7-11-20)21-12-8-14-23(16-21)32-38(34,35)24-15-9-13-22(17-24)31-27(37-4)30-19-29/h5-17,25,32H,18H2,1-4H3,(H,30,31) |
| InChIKey | GWNRUXUPKGPOLB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|