C27H24N2O4S — CID 55721516
N-[3-(benzenesulfonamido)phenyl]-2-benzhydryloxyacetamide (PubChem CID 55721516) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)phenyl]-2-benzhydryloxyacetamide.
| Compound Name | N-[3-(benzenesulfonamido)phenyl]-2-benzhydryloxyacetamide |
|---|---|
| PubChem CID | 55721516 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[3-(benzenesulfonamido)phenyl]-2-benzhydryloxyacetamide |
| SMILES | O=C(COC(c1ccccc1)c1ccccc1)Nc1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H24N2O4S/c30-26(20-33-27(21-11-4-1-5-12-21)22-13-6-2-7-14-22)28-23-15-10-16-24(19-23)29-34(31,32)25-17-8-3-9-18-25/h1-19,27,29H,20H2,(H,28,30) |
| InChIKey | XIGIBIXELFHINL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |