C19H18N4O3S — CID 23206275
2-[3-(benzenesulfonamido)anilino]-N-pyridin-4-ylacetamide (PubChem CID 23206275) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 2-[3-(benzenesulfonamido)anilino]-N-pyridin-4-ylacetamide.
| Compound Name | 2-[3-(benzenesulfonamido)anilino]-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 23206275 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-[3-(benzenesulfonamido)anilino]-N-pyridin-4-ylacetamide |
| SMILES | O=C(CNc1cccc(NS(=O)(=O)c2ccccc2)c1)Nc1ccncc1 |
| InChI | InChI=1S/C19H18N4O3S/c24-19(22-15-9-11-20-12-10-15)14-21-16-5-4-6-17(13-16)23-27(25,26)18-7-2-1-3-8-18/h1-13,21,23H,14H2,(H,20,22,24) |
| InChIKey | LDTCKWKGPGYVRY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |