C20H27N4O5S+ — CID 74424924
[2-[[3-(benzenesulfonamido)phenyl]carbamoylamino]-3-carboxypropyl]-trimethylazanium (PubChem CID 74424924) has the molecular formula C20H27N4O5S+ and a molecular weight of 435.53 g/mol. Its IUPAC name is [2-[[3-(benzenesulfonamido)phenyl]carbamoylamino]-3-carboxypropyl]-trimethylazanium.
| Compound Name | [2-[[3-(benzenesulfonamido)phenyl]carbamoylamino]-3-carboxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 74424924 |
| Molecular Formula | C20H27N4O5S+ |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [2-[[3-(benzenesulfonamido)phenyl]carbamoylamino]-3-carboxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)NC(=O)Nc1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H26N4O5S/c1-24(2,3)14-17(13-19(25)26)22-20(27)21-15-8-7-9-16(12-15)23-30(28,29)18-10-5-4-6-11-18/h4-12,17,23H,13-14H2,1-3H3,(H2-,21,22,25,26,27)/p+1 |
| InChIKey | VGNGRMURHXJKIS-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|