C24H22F2N4O3 — CID 19076802
3-[3-[[[3-(diaminomethylideneamino)benzoyl]amino]methyl]phenyl]-3-(3,5-difluorophenyl)propanoic acid (PubChem CID 19076802) has the molecular formula C24H22F2N4O3 and a molecular weight of 452.46 g/mol. Its IUPAC name is 3-[3-[[[3-(diaminomethylideneamino)benzoyl]amino]methyl]phenyl]-3-(3,5-difluorophenyl)propanoic acid.
| Compound Name | 3-[3-[[[3-(diaminomethylideneamino)benzoyl]amino]methyl]phenyl]-3-(3,5-difluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 19076802 |
| Molecular Formula | C24H22F2N4O3 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 3-[3-[[[3-(diaminomethylideneamino)benzoyl]amino]methyl]phenyl]-3-(3,5-difluorophenyl)propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCc2cccc(C(CC(=O)O)c3cc(F)cc(F)c3)c2)c1 |
| InChI | InChI=1S/C24H22F2N4O3/c25-18-8-17(9-19(26)11-18)21(12-22(31)32)15-4-1-3-14(7-15)13-29-23(33)16-5-2-6-20(10-16)30-24(27)28/h1-11,21H,12-13H2,(H,29,33)(H,31,32)(H4,27,28,30) |
| InChIKey | IKSOQYVNWCZIHW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|