C16H17N5O3 — CID 175512286
[4-[[4-(diaminomethylideneamino)benzoyl]amino]phenyl]methyl carbamate (PubChem CID 175512286) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is [4-[[4-(diaminomethylideneamino)benzoyl]amino]phenyl]methyl carbamate.
| Compound Name | [4-[[4-(diaminomethylideneamino)benzoyl]amino]phenyl]methyl carbamate |
|---|---|
| PubChem CID | 175512286 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [4-[[4-(diaminomethylideneamino)benzoyl]amino]phenyl]methyl carbamate |
| SMILES | NC(=O)OCc1ccc(NC(=O)c2ccc(N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C16H17N5O3/c17-15(18)21-13-7-3-11(4-8-13)14(22)20-12-5-1-10(2-6-12)9-24-16(19)23/h1-8H,9H2,(H2,19,23)(H,20,22)(H4,17,18,21) |
| InChIKey | GOHASTFVXNPVBK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|