C29H26N4O4S — CID 10165219
3-[2-[[4-(benzylcarbamoylamino)benzoyl]amino]phenyl]sulfanyl-3-pyridin-3-ylpropanoic acid (PubChem CID 10165219) has the molecular formula C29H26N4O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is 3-[2-[[4-(benzylcarbamoylamino)benzoyl]amino]phenyl]sulfanyl-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[2-[[4-(benzylcarbamoylamino)benzoyl]amino]phenyl]sulfanyl-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 10165219 |
| Molecular Formula | C29H26N4O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 3-[2-[[4-(benzylcarbamoylamino)benzoyl]amino]phenyl]sulfanyl-3-pyridin-3-ylpropanoic acid |
| SMILES | O=C(O)CC(Sc1ccccc1NC(=O)c1ccc(NC(=O)NCc2ccccc2)cc1)c1cccnc1 |
| InChI | InChI=1S/C29H26N4O4S/c34-27(35)17-26(22-9-6-16-30-19-22)38-25-11-5-4-10-24(25)33-28(36)21-12-14-23(15-13-21)32-29(37)31-18-20-7-2-1-3-8-20/h1-16,19,26H,17-18H2,(H,33,36)(H,34,35)(H2,31,32,37) |
| InChIKey | WARARQDFXDTZTD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |