C14H16N2O4 — CID 58770599
ethyl (Z)-3-(3,4-dimethoxyanilino)-2-isocyanoprop-2-enoate (PubChem CID 58770599) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is ethyl (Z)-3-(3,4-dimethoxyanilino)-2-isocyanoprop-2-enoate.
| Compound Name | ethyl (Z)-3-(3,4-dimethoxyanilino)-2-isocyanoprop-2-enoate |
|---|---|
| PubChem CID | 58770599 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | ethyl (Z)-3-(3,4-dimethoxyanilino)-2-isocyanoprop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\Nc1ccc(OC)c(OC)c1)C(=O)OCC |
| InChI | InChI=1S/C14H16N2O4/c1-5-20-14(17)11(15-2)9-16-10-6-7-12(18-3)13(8-10)19-4/h6-9,16H,5H2,1,3-4H3/b11-9- |
| InChIKey | ROKONQGZRQTVHW-LUAWRHEFSA-N |
| XLogP | 2.44 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|