C20H18F3N3O — CID 108850662
(Z)-2-cyano-N-(2-ethyl-6-methylphenyl)-3-[3-(trifluoromethyl)anilino]prop-2-enamide (PubChem CID 108850662) has the molecular formula C20H18F3N3O and a molecular weight of 373.38 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-ethyl-6-methylphenyl)-3-[3-(trifluoromethyl)anilino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-ethyl-6-methylphenyl)-3-[3-(trifluoromethyl)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108850662 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (Z)-2-cyano-N-(2-ethyl-6-methylphenyl)-3-[3-(trifluoromethyl)anilino]prop-2-enamide |
| SMILES | CCc1cccc(C)c1NC(=O)/C(C#N)=C\Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F3N3O/c1-3-14-7-4-6-13(2)18(14)26-19(27)15(11-24)12-25-17-9-5-8-16(10-17)20(21,22)23/h4-10,12,25H,3H2,1-2H3,(H,26,27)/b15-12- |
| InChIKey | IIKXOSDUTTXORT-QINSGFPZSA-N |
| XLogP | 5.03 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|