C13H9F5N4O3 — CID 88723933
ethyl N-[(Z)-3-(N-amino-2,3,4,5,6-pentafluoroanilino)-2-cyanoprop-2-enoyl]carbamate (PubChem CID 88723933) has the molecular formula C13H9F5N4O3 and a molecular weight of 364.23 g/mol. Its IUPAC name is ethyl N-[(Z)-3-(N-amino-2,3,4,5,6-pentafluoroanilino)-2-cyanoprop-2-enoyl]carbamate.
| Compound Name | ethyl N-[(Z)-3-(N-amino-2,3,4,5,6-pentafluoroanilino)-2-cyanoprop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 88723933 |
| Molecular Formula | C13H9F5N4O3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | ethyl N-[(Z)-3-(N-amino-2,3,4,5,6-pentafluoroanilino)-2-cyanoprop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=C\N(N)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H9F5N4O3/c1-2-25-13(24)21-12(23)5(3-19)4-22(20)11-9(17)7(15)6(14)8(16)10(11)18/h4H,2,20H2,1H3,(H,21,23,24)/b5-4- |
| InChIKey | LYLXTRRZWDFFGC-PLNGDYQASA-N |
| XLogP | 1.74 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|