C21H13Cl4N5O5 — CID 169146547
ethyl N-[(Z)-2-cyano-3-[3,5-dichloro-4-[(6,7-dichloro-4-oxo-3H-phthalazin-1-yl)oxy]anilino]prop-2-enoyl]carbamate (PubChem CID 169146547) has the molecular formula C21H13Cl4N5O5 and a molecular weight of 557.18 g/mol. Its IUPAC name is ethyl N-[(Z)-2-cyano-3-[3,5-dichloro-4-[(6,7-dichloro-4-oxo-3H-phthalazin-1-yl)oxy]anilino]prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[(Z)-2-cyano-3-[3,5-dichloro-4-[(6,7-dichloro-4-oxo-3H-phthalazin-1-yl)oxy]anilino]prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 169146547 |
| Molecular Formula | C21H13Cl4N5O5 |
| Molecular Weight | 557.18 g/mol |
| Exact Mass | 554.97 |
| IUPAC Name | ethyl N-[(Z)-2-cyano-3-[3,5-dichloro-4-[(6,7-dichloro-4-oxo-3H-phthalazin-1-yl)oxy]anilino]prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=C\Nc1cc(Cl)c(Oc2n[nH]c(=O)c3cc(Cl)c(Cl)cc23)c(Cl)c1 |
| InChI | InChI=1S/C21H13Cl4N5O5/c1-2-34-21(33)28-18(31)9(7-26)8-27-10-3-15(24)17(16(25)4-10)35-20-12-6-14(23)13(22)5-11(12)19(32)29-30-20/h3-6,8,27H,2H2,1H3,(H,29,32)(H,28,31,33)/b9-8- |
| InChIKey | MTDNVAGYWPPNOC-HJWRWDBZSA-N |
| XLogP | 5.42 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.18 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|