C19H18ClFN6O5 — CID 172950597
ethyl N-[(2Z)-2-[[3-chloro-5-fluoro-4-[[6-oxo-4-(1,1,1-trideuteriopropan-2-yl)-1H-pyridazin-3-yl]oxy]phenyl]hydrazinylidene]-2-cyanoacetyl]carbamate (PubChem CID 172950597) has the molecular formula C19H18ClFN6O5 and a molecular weight of 467.86 g/mol. Its IUPAC name is ethyl N-[(2Z)-2-[[3-chloro-5-fluoro-4-[[6-oxo-4-(1,1,1-trideuteriopropan-2-yl)-1H-pyridazin-3-yl]oxy]phenyl]hydrazinylidene]-2-cyanoacetyl]carbamate.
| Compound Name | ethyl N-[(2Z)-2-[[3-chloro-5-fluoro-4-[[6-oxo-4-(1,1,1-trideuteriopropan-2-yl)-1H-pyridazin-3-yl]oxy]phenyl]hydrazinylidene]-2-cyanoacetyl]carbamate |
|---|---|
| PubChem CID | 172950597 |
| Molecular Formula | C19H18ClFN6O5 |
| Molecular Weight | 467.86 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | ethyl N-[(2Z)-2-[[3-chloro-5-fluoro-4-[[6-oxo-4-(1,1,1-trideuteriopropan-2-yl)-1H-pyridazin-3-yl]oxy]phenyl]hydrazinylidene]-2-cyanoacetyl]carbamate |
| SMILES | [2H]C([2H])([2H])C(C)c1cc(=O)[nH]nc1Oc1c(F)cc(N/N=C(/C#N)C(=O)NC(=O)OCC)cc1Cl |
| InChI | InChI=1S/C19H18ClFN6O5/c1-4-31-19(30)23-17(29)14(8-22)25-24-10-5-12(20)16(13(21)6-10)32-18-11(9(2)3)7-15(28)26-27-18/h5-7,9,24H,4H2,1-3H3,(H,26,28)(H,23,29,30)/b25-14-/i2D3 |
| InChIKey | VSYXPUKFBIISBZ-IWDNWBCESA-N |
| XLogP | 3.04 |
| TPSA | 158.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|