C22H23ClN6O5 — CID 153374466
ethyl N-[(2E)-2-[[6-chloro-7-[(6-oxo-4-propan-2-yl-1H-pyridazin-3-yl)oxy]-2,3-dihydro-1H-inden-4-yl]hydrazinylidene]-2-cyanoacetyl]carbamate (PubChem CID 153374466) has the molecular formula C22H23ClN6O5 and a molecular weight of 486.92 g/mol. Its IUPAC name is ethyl N-[(2E)-2-[[6-chloro-7-[(6-oxo-4-propan-2-yl-1H-pyridazin-3-yl)oxy]-2,3-dihydro-1H-inden-4-yl]hydrazinylidene]-2-cyanoacetyl]carbamate.
| Compound Name | ethyl N-[(2E)-2-[[6-chloro-7-[(6-oxo-4-propan-2-yl-1H-pyridazin-3-yl)oxy]-2,3-dihydro-1H-inden-4-yl]hydrazinylidene]-2-cyanoacetyl]carbamate |
|---|---|
| PubChem CID | 153374466 |
| Molecular Formula | C22H23ClN6O5 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | ethyl N-[(2E)-2-[[6-chloro-7-[(6-oxo-4-propan-2-yl-1H-pyridazin-3-yl)oxy]-2,3-dihydro-1H-inden-4-yl]hydrazinylidene]-2-cyanoacetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=N/Nc1cc(Cl)c(Oc2n[nH]c(=O)cc2C(C)C)c2c1CCC2 |
| InChI | InChI=1S/C22H23ClN6O5/c1-4-33-22(32)25-20(31)17(10-24)27-26-16-9-15(23)19(13-7-5-6-12(13)16)34-21-14(11(2)3)8-18(30)28-29-21/h8-9,11,26H,4-7H2,1-3H3,(H,28,30)(H,25,31,32)/b27-17+ |
| InChIKey | PTXXEKAUBLBYJS-WPWMEQJKSA-N |
| XLogP | 3.39 |
| TPSA | 158.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|