C23H24Cl2N6O6 — CID 155363490
ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-[(4-oxo-5-propan-2-yloxy-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 155363490) has the molecular formula C23H24Cl2N6O6 and a molecular weight of 551.39 g/mol. Its IUPAC name is ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-[(4-oxo-5-propan-2-yloxy-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-[(4-oxo-5-propan-2-yloxy-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 155363490 |
| Molecular Formula | C23H24Cl2N6O6 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-[(4-oxo-5-propan-2-yloxy-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=N\Nc1cc(Cl)c(Oc2n[nH]c(=O)c3c2CCCC3OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C23H24Cl2N6O6/c1-4-35-23(34)27-20(32)16(10-26)29-28-12-8-14(24)19(15(25)9-12)37-22-13-6-5-7-17(36-11(2)3)18(13)21(33)30-31-22/h8-9,11,17,28H,4-7H2,1-3H3,(H,30,33)(H,27,32,34)/b29-16- |
| InChIKey | BLJHUGGMSVFKKY-MWLSYYOVSA-N |
| XLogP | 4.24 |
| TPSA | 167.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|