C22H26Cl2N6O4S — CID 143395618
ethane;ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)sulfanylphenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 143395618) has the molecular formula C22H26Cl2N6O4S and a molecular weight of 541.46 g/mol. Its IUPAC name is ethane;ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)sulfanylphenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethane;ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)sulfanylphenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 143395618 |
| Molecular Formula | C22H26Cl2N6O4S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | ethane;ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)sulfanylphenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CC.CCOC(=O)NC(=O)/C(C#N)=N\Nc1cc(Cl)c(Sc2cc(C(C)C)c(=O)n(C)n2)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N6O4S.C2H6/c1-5-32-20(31)24-18(29)15(9-23)26-25-11-6-13(21)17(14(22)7-11)33-16-8-12(10(2)3)19(30)28(4)27-16;1-2/h6-8,10,25H,5H2,1-4H3,(H,24,29,31);1-2H3/b26-15-; |
| InChIKey | IBCYPABETLBBFA-JCYJKQRTSA-N |
| XLogP | 4.95 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|