C22H23Cl2N5O4 — CID 172988667
ethyl (4E)-4-cyano-4-[[3,5-dichloro-4-[(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)methyl]phenyl]hydrazinylidene]-3-oxobutanoate (PubChem CID 172988667) has the molecular formula C22H23Cl2N5O4 and a molecular weight of 492.36 g/mol. Its IUPAC name is ethyl (4E)-4-cyano-4-[[3,5-dichloro-4-[(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)methyl]phenyl]hydrazinylidene]-3-oxobutanoate.
| Compound Name | ethyl (4E)-4-cyano-4-[[3,5-dichloro-4-[(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)methyl]phenyl]hydrazinylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 172988667 |
| Molecular Formula | C22H23Cl2N5O4 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | ethyl (4E)-4-cyano-4-[[3,5-dichloro-4-[(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)methyl]phenyl]hydrazinylidene]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)/C(C#N)=N/Nc1cc(Cl)c(Cc2cc(C(C)C)c(=O)n(C)n2)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl2N5O4/c1-5-33-21(31)10-20(30)19(11-25)27-26-13-8-17(23)16(18(24)9-13)7-14-6-15(12(2)3)22(32)29(4)28-14/h6,8-9,12,26H,5,7,10H2,1-4H3/b27-19+ |
| InChIKey | JMFQWUOBWZBYOZ-ZXVVBBHZSA-N |
| XLogP | 3.62 |
| TPSA | 126.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|