C31H33N7O5S — CID 166698798
ethyl N-[(2Z)-2-cyano-2-[[3,5-dimethyl-4-[[5-(4-methylphenyl)sulfonyl-7-propan-2-ylpyrrolo[2,3-b]pyrazin-2-yl]methyl]phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 166698798) has the molecular formula C31H33N7O5S and a molecular weight of 615.72 g/mol. Its IUPAC name is ethyl N-[(2Z)-2-cyano-2-[[3,5-dimethyl-4-[[5-(4-methylphenyl)sulfonyl-7-propan-2-ylpyrrolo[2,3-b]pyrazin-2-yl]methyl]phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[(2Z)-2-cyano-2-[[3,5-dimethyl-4-[[5-(4-methylphenyl)sulfonyl-7-propan-2-ylpyrrolo[2,3-b]pyrazin-2-yl]methyl]phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 166698798 |
| Molecular Formula | C31H33N7O5S |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | ethyl N-[(2Z)-2-cyano-2-[[3,5-dimethyl-4-[[5-(4-methylphenyl)sulfonyl-7-propan-2-ylpyrrolo[2,3-b]pyrazin-2-yl]methyl]phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=N\Nc1cc(C)c(Cc2cnc3c(n2)c(C(C)C)cn3S(=O)(=O)c2ccc(C)cc2)c(C)c1 |
| InChI | InChI=1S/C31H33N7O5S/c1-7-43-31(40)35-30(39)27(15-32)37-36-22-12-20(5)25(21(6)13-22)14-23-16-33-29-28(34-23)26(18(2)3)17-38(29)44(41,42)24-10-8-19(4)9-11-24/h8-13,16-18,36H,7,14H2,1-6H3,(H,35,39,40)/b37-27- |
| InChIKey | YECGJMZLTRNYHS-QOSQFQCFSA-N |
| XLogP | 4.87 |
| TPSA | 168.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|