C23H22ClF3N2O2 — CID 2342496
(Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-(4-hexoxyphenyl)prop-2-enamide (PubChem CID 2342496) has the molecular formula C23H22ClF3N2O2 and a molecular weight of 450.89 g/mol. Its IUPAC name is (Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-(4-hexoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-(4-hexoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2342496 |
| Molecular Formula | C23H22ClF3N2O2 |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-(4-hexoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(/C=C(/C#N)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H22ClF3N2O2/c1-2-3-4-5-12-31-19-9-6-16(7-10-19)13-17(15-28)22(30)29-21-14-18(23(25,26)27)8-11-20(21)24/h6-11,13-14H,2-5,12H2,1H3,(H,29,30)/b17-13- |
| InChIKey | ZYQJBPZBNADCLD-LGMDPLHJSA-N |
| XLogP | 6.86 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|