C25H28F3N3O3S — CID 137037768
4-[2-(diethylamino)ethylimino]-5-[[3-methoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-1,3-thiazolidin-2-one (PubChem CID 137037768) has the molecular formula C25H28F3N3O3S and a molecular weight of 507.58 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethylimino]-5-[[3-methoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-1,3-thiazolidin-2-one.
| Compound Name | 4-[2-(diethylamino)ethylimino]-5-[[3-methoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 137037768 |
| Molecular Formula | C25H28F3N3O3S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 4-[2-(diethylamino)ethylimino]-5-[[3-methoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-1,3-thiazolidin-2-one |
| SMILES | CCN(CC)CC/N=C1\NC(=O)SC1=Cc1ccc(OCc2ccc(C(F)(F)F)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H28F3N3O3S/c1-4-31(5-2)13-12-29-23-22(35-24(32)30-23)15-18-8-11-20(21(14-18)33-3)34-16-17-6-9-19(10-7-17)25(26,27)28/h6-11,14-15H,4-5,12-13,16H2,1-3H3,(H,29,30,32) |
| InChIKey | VSVWENSRRWYVMG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|