C19H10ClF6NO2S2 — CID 87424573
(5Z)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-chlorophenyl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 87424573) has the molecular formula C19H10ClF6NO2S2 and a molecular weight of 497.87 g/mol. Its IUPAC name is (5Z)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-chlorophenyl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-chlorophenyl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 87424573 |
| Molecular Formula | C19H10ClF6NO2S2 |
| Molecular Weight | 497.87 g/mol |
| Exact Mass | 496.97 |
| IUPAC Name | (5Z)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-chlorophenyl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=S)/C(=C/c2ccc(OCc3ccc(C(F)(F)F)cc3C(F)(F)F)cc2Cl)S1 |
| InChI | InChI=1S/C19H10ClF6NO2S2/c20-14-7-12(4-2-9(14)5-15-16(30)27-17(28)31-15)29-8-10-1-3-11(18(21,22)23)6-13(10)19(24,25)26/h1-7H,8H2,(H,27,28,30)/b15-5- |
| InChIKey | DQYVAHNZWMGRDY-WCSRMQSCSA-N |
| XLogP | 7.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.87 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|