C24H17F2NO4S — CID 56679983
(5Z)-5-[[2,4-bis[(4-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 56679983) has the molecular formula C24H17F2NO4S and a molecular weight of 453.47 g/mol. Its IUPAC name is (5Z)-5-[[2,4-bis[(4-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2,4-bis[(4-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 56679983 |
| Molecular Formula | C24H17F2NO4S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (5Z)-5-[[2,4-bis[(4-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OCc3ccc(F)cc3)cc2OCc2ccc(F)cc2)S1 |
| InChI | InChI=1S/C24H17F2NO4S/c25-18-6-1-15(2-7-18)13-30-20-10-5-17(11-22-23(28)27-24(29)32-22)21(12-20)31-14-16-3-8-19(26)9-4-16/h1-12H,13-14H2,(H,27,28,29)/b22-11- |
| InChIKey | TZJXGAUZPKGKBD-JJFYIABZSA-N |
| XLogP | 5.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|