C24H15Cl4NO4S — CID 23562681
(5Z)-5-[[5-[(2,3-dichlorophenyl)methoxy]-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 23562681) has the molecular formula C24H15Cl4NO4S and a molecular weight of 555.27 g/mol. Its IUPAC name is (5Z)-5-[[5-[(2,3-dichlorophenyl)methoxy]-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-[(2,3-dichlorophenyl)methoxy]-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 23562681 |
| Molecular Formula | C24H15Cl4NO4S |
| Molecular Weight | 555.27 g/mol |
| Exact Mass | 552.95 |
| IUPAC Name | (5Z)-5-[[5-[(2,3-dichlorophenyl)methoxy]-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc(OCc3cccc(Cl)c3Cl)ccc2OCc2ccc(Cl)c(Cl)c2)S1 |
| InChI | InChI=1S/C24H15Cl4NO4S/c25-17-6-4-13(8-19(17)27)11-33-20-7-5-16(32-12-14-2-1-3-18(26)22(14)28)9-15(20)10-21-23(30)29-24(31)34-21/h1-10H,11-12H2,(H,29,30,31)/b21-10- |
| InChIKey | ANMONIWIUOTMDQ-FBHDLOMBSA-N |
| XLogP | 7.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.27 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|