C24H18FNO4S — CID 56662949
(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-2-phenylmethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 56662949) has the molecular formula C24H18FNO4S and a molecular weight of 435.48 g/mol. Its IUPAC name is (5Z)-5-[[4-[(4-fluorophenyl)methoxy]-2-phenylmethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(4-fluorophenyl)methoxy]-2-phenylmethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 56662949 |
| Molecular Formula | C24H18FNO4S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | (5Z)-5-[[4-[(4-fluorophenyl)methoxy]-2-phenylmethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OCc3ccc(F)cc3)cc2OCc2ccccc2)S1 |
| InChI | InChI=1S/C24H18FNO4S/c25-19-9-6-17(7-10-19)14-29-20-11-8-18(12-22-23(27)26-24(28)31-22)21(13-20)30-15-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,26,27,28)/b22-12- |
| InChIKey | LVPAAEJZWBWWJL-UUYOSTAYSA-N |
| XLogP | 5.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|