C30H22N2O3S — CID 10368305
(5E)-5-[[1-(naphthalen-2-ylmethyl)-5-phenylmethoxyindol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10368305) has the molecular formula C30H22N2O3S and a molecular weight of 490.58 g/mol. Its IUPAC name is (5E)-5-[[1-(naphthalen-2-ylmethyl)-5-phenylmethoxyindol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-(naphthalen-2-ylmethyl)-5-phenylmethoxyindol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10368305 |
| Molecular Formula | C30H22N2O3S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | (5E)-5-[[1-(naphthalen-2-ylmethyl)-5-phenylmethoxyindol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cc3cc(OCc4ccccc4)ccc3n2Cc2ccc3ccccc3c2)S1 |
| InChI | InChI=1S/C30H22N2O3S/c33-29-28(36-30(34)31-29)17-25-15-24-16-26(35-19-20-6-2-1-3-7-20)12-13-27(24)32(25)18-21-10-11-22-8-4-5-9-23(22)14-21/h1-17H,18-19H2,(H,31,33,34)/b28-17+ |
| InChIKey | ISSHANURJKHZRG-OGLMXYFKSA-N |
| XLogP | 6.75 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|