C36H24F6N2O5S — CID 59100200
4-[[(5E)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 59100200) has the molecular formula C36H24F6N2O5S and a molecular weight of 710.65 g/mol. Its IUPAC name is 4-[[(5E)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[(5E)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 59100200 |
| Molecular Formula | C36H24F6N2O5S |
| Molecular Weight | 710.65 g/mol |
| Exact Mass | 710.13 |
| IUPAC Name | 4-[[(5E)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C(=O)S/C(=C/c3cc4cc(OCc5ccccc5)ccc4n3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C36H24F6N2O5S/c37-35(38,39)26-11-10-24(29(16-26)36(40,41)42)19-43-27(14-25-15-28(12-13-30(25)43)49-20-22-4-2-1-3-5-22)17-31-32(45)44(34(48)50-31)18-21-6-8-23(9-7-21)33(46)47/h1-17H,18-20H2,(H,46,47)/b31-17+ |
| InChIKey | DKPNQVXYKLJTNP-KBVAKVRCSA-N |
| XLogP | 9.24 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.65 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|