C28H20F6N2O2S2 — CID 142647526
(1E)-1-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 142647526) has the molecular formula C28H20F6N2O2S2 and a molecular weight of 594.60 g/mol. Its IUPAC name is (1E)-1-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (1E)-1-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142647526 |
| Molecular Formula | C28H20F6N2O2S2 |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | (1E)-1-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C/S(=C\c2cc3cc(OCc4ccccc4)ccc3n2Cc2ccc(C(F)(F)F)cc2C(F)(F)F)C(=S)N1 |
| InChI | InChI=1S/C28H20F6N2O2S2/c29-27(30,31)20-7-6-18(23(12-20)28(32,33)34)13-36-21(15-40-16-25(37)35-26(40)39)10-19-11-22(8-9-24(19)36)38-14-17-4-2-1-3-5-17/h1-12,15H,13-14,16H2,(H,35,37,39) |
| InChIKey | RJZAQGMUQUFHGH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|