C26H29F5N3O3PS — CID 143222439
[difluoro-[4-[(2-methoxy-4-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl]methyl]phosphane;5-ethylidene-2-piperazin-1-yl-1,3-thiazol-4-one (PubChem CID 143222439) has the molecular formula C26H29F5N3O3PS and a molecular weight of 589.57 g/mol. Its IUPAC name is [difluoro-[4-[(2-methoxy-4-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl]methyl]phosphane;5-ethylidene-2-piperazin-1-yl-1,3-thiazol-4-one.
| Compound Name | [difluoro-[4-[(2-methoxy-4-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl]methyl]phosphane;5-ethylidene-2-piperazin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 143222439 |
| Molecular Formula | C26H29F5N3O3PS |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | [difluoro-[4-[(2-methoxy-4-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl]methyl]phosphane;5-ethylidene-2-piperazin-1-yl-1,3-thiazol-4-one |
| SMILES | CC=C1SC(N2CCNCC2)=NC1=O.COc1cc(C)ccc1OCc1ccc(C(F)(F)P)cc1C(F)(F)F |
| InChI | InChI=1S/C17H16F5O2P.C9H13N3OS/c1-10-3-6-14(15(7-10)23-2)24-9-11-4-5-12(17(21,22)25)8-13(11)16(18,19)20;1-2-7-8(13)11-9(14-7)12-5-3-10-4-6-12/h3-8H,9,25H2,1-2H3;2,10H,3-6H2,1H3 |
| InChIKey | CTIOPCUOBWFYED-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|