C23H23NO4 — CID 20986156
4-[[2-[(3-methylphenyl)methoxy]naphthalen-1-yl]methylamino]-4-oxobutanoic acid (PubChem CID 20986156) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-[[2-[(3-methylphenyl)methoxy]naphthalen-1-yl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[2-[(3-methylphenyl)methoxy]naphthalen-1-yl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20986156 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-[[2-[(3-methylphenyl)methoxy]naphthalen-1-yl]methylamino]-4-oxobutanoic acid |
| SMILES | Cc1cccc(COc2ccc3ccccc3c2CNC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C23H23NO4/c1-16-5-4-6-17(13-16)15-28-21-10-9-18-7-2-3-8-19(18)20(21)14-24-22(25)11-12-23(26)27/h2-10,13H,11-12,14-15H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | IJDLDJOVZGSQFX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |