C14H20O6 — CID 107744915
2-ethoxy-4-[4-(hydroxymethyl)-2-methoxyphenoxy]butanoic acid (PubChem CID 107744915) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-ethoxy-4-[4-(hydroxymethyl)-2-methoxyphenoxy]butanoic acid.
| Compound Name | 2-ethoxy-4-[4-(hydroxymethyl)-2-methoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 107744915 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-ethoxy-4-[4-(hydroxymethyl)-2-methoxyphenoxy]butanoic acid |
| SMILES | CCOC(CCOc1ccc(CO)cc1OC)C(=O)O |
| InChI | InChI=1S/C14H20O6/c1-3-19-12(14(16)17)6-7-20-11-5-4-10(9-15)8-13(11)18-2/h4-5,8,12,15H,3,6-7,9H2,1-2H3,(H,16,17) |
| InChIKey | JYOLONGLRRDHRJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |