C18H21NO2 — CID 106713098
6-(3-hydroxynaphthalen-2-yl)oxy-2,2-dimethylhexanenitrile (PubChem CID 106713098) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 6-(3-hydroxynaphthalen-2-yl)oxy-2,2-dimethylhexanenitrile.
| Compound Name | 6-(3-hydroxynaphthalen-2-yl)oxy-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106713098 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 6-(3-hydroxynaphthalen-2-yl)oxy-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1cc2ccccc2cc1O |
| InChI | InChI=1S/C18H21NO2/c1-18(2,13-19)9-5-6-10-21-17-12-15-8-4-3-7-14(15)11-16(17)20/h3-4,7-8,11-12,20H,5-6,9-10H2,1-2H3 |
| InChIKey | OIFOGLXAJNISAP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|