C16H20O3 — CID 107704307
3-(6-hydroxyhexoxy)naphthalen-2-ol (PubChem CID 107704307) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-(6-hydroxyhexoxy)naphthalen-2-ol.
| Compound Name | 3-(6-hydroxyhexoxy)naphthalen-2-ol |
|---|---|
| PubChem CID | 107704307 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-(6-hydroxyhexoxy)naphthalen-2-ol |
| SMILES | OCCCCCCOc1cc2ccccc2cc1O |
| InChI | InChI=1S/C16H20O3/c17-9-5-1-2-6-10-19-16-12-14-8-4-3-7-13(14)11-15(16)18/h3-4,7-8,11-12,17-18H,1-2,5-6,9-10H2 |
| InChIKey | ABBYJLSJSIZEBM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|