C14H17ClN2O3 — CID 106710394
6-(4-chloro-2-nitrophenoxy)-2,2-dimethylhexanenitrile (PubChem CID 106710394) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 6-(4-chloro-2-nitrophenoxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-chloro-2-nitrophenoxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106710394 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 6-(4-chloro-2-nitrophenoxy)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17ClN2O3/c1-14(2,10-16)7-3-4-8-20-13-6-5-11(15)9-12(13)17(18)19/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | YZPRJVNECFAFEN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|