C11H11ClF3NO3 — CID 115514392
4-(chloromethyl)-2-nitro-1-(4,4,4-trifluorobutoxy)benzene (PubChem CID 115514392) has the molecular formula C11H11ClF3NO3 and a molecular weight of 297.66 g/mol. Its IUPAC name is 4-(chloromethyl)-2-nitro-1-(4,4,4-trifluorobutoxy)benzene.
| Compound Name | 4-(chloromethyl)-2-nitro-1-(4,4,4-trifluorobutoxy)benzene |
|---|---|
| PubChem CID | 115514392 |
| Molecular Formula | C11H11ClF3NO3 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 4-(chloromethyl)-2-nitro-1-(4,4,4-trifluorobutoxy)benzene |
| SMILES | O=[N+]([O-])c1cc(CCl)ccc1OCCCC(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO3/c12-7-8-2-3-10(9(6-8)16(17)18)19-5-1-4-11(13,14)15/h2-3,6H,1,4-5,7H2 |
| InChIKey | GRSVMZKHIOOHIT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|