C13H17ClN2O — CID 79800555
5-[[6-(chloromethyl)-3-pyridinyl]oxy]-2,2-dimethylpentanenitrile (PubChem CID 79800555) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 5-[[6-(chloromethyl)-3-pyridinyl]oxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[[6-(chloromethyl)-3-pyridinyl]oxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 79800555 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 5-[[6-(chloromethyl)-3-pyridinyl]oxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1ccc(CCl)nc1 |
| InChI | InChI=1S/C13H17ClN2O/c1-13(2,10-15)6-3-7-17-12-5-4-11(8-14)16-9-12/h4-5,9H,3,6-8H2,1-2H3 |
| InChIKey | JAFWYAFPWCNGGC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|