C13H18N2O3 — CID 94690084
2-methyl-2-(3,4,5-trimethoxyanilino)propanenitrile (PubChem CID 94690084) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-methyl-2-(3,4,5-trimethoxyanilino)propanenitrile.
| Compound Name | 2-methyl-2-(3,4,5-trimethoxyanilino)propanenitrile |
|---|---|
| PubChem CID | 94690084 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-methyl-2-(3,4,5-trimethoxyanilino)propanenitrile |
| SMILES | COc1cc(NC(C)(C)C#N)cc(OC)c1OC |
| InChI | InChI=1S/C13H18N2O3/c1-13(2,8-14)15-9-6-10(16-3)12(18-5)11(7-9)17-4/h6-7,15H,1-5H3 |
| InChIKey | BSUOKLJWKXMQMQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|