C17H25NO5 — CID 23349313
3,3-diethoxy-2-methyl-2-(3,4,5-trimethoxyphenyl)propanenitrile (PubChem CID 23349313) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3,3-diethoxy-2-methyl-2-(3,4,5-trimethoxyphenyl)propanenitrile.
| Compound Name | 3,3-diethoxy-2-methyl-2-(3,4,5-trimethoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 23349313 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3,3-diethoxy-2-methyl-2-(3,4,5-trimethoxyphenyl)propanenitrile |
| SMILES | CCOC(OCC)C(C)(C#N)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H25NO5/c1-7-22-16(23-8-2)17(3,11-18)12-9-13(19-4)15(21-6)14(10-12)20-5/h9-10,16H,7-8H2,1-6H3 |
| InChIKey | DNMBZCAAEVOUGA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|