C24H28FN3O4 — CID 29200234
N-[2-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]ethyl]-4-fluorobenzamide (PubChem CID 29200234) has the molecular formula C24H28FN3O4 and a molecular weight of 441.50 g/mol. Its IUPAC name is N-[2-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 29200234 |
| Molecular Formula | C24H28FN3O4 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[2-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]ethyl]-4-fluorobenzamide |
| SMILES | COc1ccc(/C=C/C(=O)N2CCN(CCNC(=O)c3ccc(F)cc3)CC2)cc1OC |
| InChI | InChI=1S/C24H28FN3O4/c1-31-21-9-3-18(17-22(21)32-2)4-10-23(29)28-15-13-27(14-16-28)12-11-26-24(30)19-5-7-20(25)8-6-19/h3-10,17H,11-16H2,1-2H3,(H,26,30)/b10-4+ |
| InChIKey | CVINSGYPFBXMBW-ONNFQVAWSA-N |
| XLogP | 2.43 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|