C19H25N3O3 — CID 89013625
(2E,5E)-6-(3,4-dimethoxyphenyl)-4-imino-1-(4-methylpiperazin-1-yl)hexa-2,5-dien-1-one (PubChem CID 89013625) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2E,5E)-6-(3,4-dimethoxyphenyl)-4-imino-1-(4-methylpiperazin-1-yl)hexa-2,5-dien-1-one.
| Compound Name | (2E,5E)-6-(3,4-dimethoxyphenyl)-4-imino-1-(4-methylpiperazin-1-yl)hexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 89013625 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (2E,5E)-6-(3,4-dimethoxyphenyl)-4-imino-1-(4-methylpiperazin-1-yl)hexa-2,5-dien-1-one |
| SMILES | [H]/N=C(\C=C\C(=O)N1CCN(C)CC1)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-21-10-12-22(13-11-21)19(23)9-7-16(20)6-4-15-5-8-17(24-2)18(14-15)25-3/h4-9,14,20H,10-13H2,1-3H3/b6-4+,9-7+,20-16- |
| InChIKey | MKVGZQRZFRUGIF-BABNQAMTSA-N |
| XLogP | 2.07 |
| TPSA | 65.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|