C21H34N4O3S — CID 17066646
N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-(2-piperidin-4-ylethylamino)acetamide (PubChem CID 17066646) has the molecular formula C21H34N4O3S and a molecular weight of 422.60 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-(2-piperidin-4-ylethylamino)acetamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-(2-piperidin-4-ylethylamino)acetamide |
|---|---|
| PubChem CID | 17066646 |
| Molecular Formula | C21H34N4O3S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-(2-piperidin-4-ylethylamino)acetamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(NC(=O)CNCCC3CCNCC3)cc2)CC1 |
| InChI | InChI=1S/C21H34N4O3S/c1-17-9-14-25(15-10-17)29(27,28)20-4-2-19(3-5-20)24-21(26)16-23-13-8-18-6-11-22-12-7-18/h2-5,17-18,22-23H,6-16H2,1H3,(H,24,26) |
| InChIKey | VKYRHXXBESMSDC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|