C14H21BrN2O4S — CID 120725803
1-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2,3-dimethylpiperazine (PubChem CID 120725803) has the molecular formula C14H21BrN2O4S and a molecular weight of 393.30 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2,3-dimethylpiperazine.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2,3-dimethylpiperazine |
|---|---|
| PubChem CID | 120725803 |
| Molecular Formula | C14H21BrN2O4S |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2,3-dimethylpiperazine |
| SMILES | COc1cc(Br)c(S(=O)(=O)N2CCNC(C)C2C)cc1OC |
| InChI | InChI=1S/C14H21BrN2O4S/c1-9-10(2)17(6-5-16-9)22(18,19)14-8-13(21-4)12(20-3)7-11(14)15/h7-10,16H,5-6H2,1-4H3 |
| InChIKey | IVJMEXPACLNYRK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |