C13H19BrN2O4S — CID 82745353
(2R)-1-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2-methylpiperazine (PubChem CID 82745353) has the molecular formula C13H19BrN2O4S and a molecular weight of 379.28 g/mol. Its IUPAC name is (2R)-1-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2-methylpiperazine.
| Compound Name | (2R)-1-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2-methylpiperazine |
|---|---|
| PubChem CID | 82745353 |
| Molecular Formula | C13H19BrN2O4S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | (2R)-1-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2-methylpiperazine |
| SMILES | COc1cc(Br)c(S(=O)(=O)N2CCNC[C@H]2C)cc1OC |
| InChI | InChI=1S/C13H19BrN2O4S/c1-9-8-15-4-5-16(9)21(17,18)13-7-12(20-3)11(19-2)6-10(13)14/h6-7,9,15H,4-5,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | HUCMYMXSJAPUEF-SECBINFHSA-N |
| XLogP | 1.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |