C17H24BrNO4S — CID 102413535
2-bromo-N-[2-(cyclohexen-1-yl)ethyl]-4,5-dimethoxy-N-methylbenzenesulfonamide (PubChem CID 102413535) has the molecular formula C17H24BrNO4S and a molecular weight of 418.35 g/mol. Its IUPAC name is 2-bromo-N-[2-(cyclohexen-1-yl)ethyl]-4,5-dimethoxy-N-methylbenzenesulfonamide.
| Compound Name | 2-bromo-N-[2-(cyclohexen-1-yl)ethyl]-4,5-dimethoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102413535 |
| Molecular Formula | C17H24BrNO4S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 2-bromo-N-[2-(cyclohexen-1-yl)ethyl]-4,5-dimethoxy-N-methylbenzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)N(C)CCC2=CCCCC2)cc1OC |
| InChI | InChI=1S/C17H24BrNO4S/c1-19(10-9-13-7-5-4-6-8-13)24(20,21)17-12-16(23-3)15(22-2)11-14(17)18/h7,11-12H,4-6,8-10H2,1-3H3 |
| InChIKey | QXCVTXVHKSVVRV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|